C16H20ClN2OS+ — CID 8769698
[(2S)-1-(3-chloroanilino)-1-oxopropan-2-yl]-ethyl-(thiophen-2-ylmethyl)azanium (PubChem CID 8769698) has the molecular formula C16H20ClN2OS+ and a molecular weight of 323.87 g/mol. Its IUPAC name is [(2S)-1-(3-chloroanilino)-1-oxopropan-2-yl]-ethyl-(thiophen-2-ylmethyl)azanium.
| Compound Name | [(2S)-1-(3-chloroanilino)-1-oxopropan-2-yl]-ethyl-(thiophen-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8769698 |
| Molecular Formula | C16H20ClN2OS+ |
| Molecular Weight | 323.87 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | [(2S)-1-(3-chloroanilino)-1-oxopropan-2-yl]-ethyl-(thiophen-2-ylmethyl)azanium |
| SMILES | CC[NH+](Cc1cccs1)[C@@H](C)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H19ClN2OS/c1-3-19(11-15-8-5-9-21-15)12(2)16(20)18-14-7-4-6-13(17)10-14/h4-10,12H,3,11H2,1-2H3,(H,18,20)/p+1/t12-/m0/s1 |
| InChIKey | UUMNYPFALHNWEQ-LBPRGKRZSA-O |
| XLogP | 2.83 |
| TPSA | 33.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.87 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |