C25H42O3S — CID 87698591
3,5-ditert-butyl-2-ethyl-4-hydroxy-6-octylsulfanylbenzoic acid (PubChem CID 87698591) has the molecular formula C25H42O3S and a molecular weight of 422.68 g/mol. Its IUPAC name is 3,5-ditert-butyl-2-ethyl-4-hydroxy-6-octylsulfanylbenzoic acid.
| Compound Name | 3,5-ditert-butyl-2-ethyl-4-hydroxy-6-octylsulfanylbenzoic acid |
|---|---|
| PubChem CID | 87698591 |
| Molecular Formula | C25H42O3S |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | 3,5-ditert-butyl-2-ethyl-4-hydroxy-6-octylsulfanylbenzoic acid |
| SMILES | CCCCCCCCSc1c(C(=O)O)c(CC)c(C(C)(C)C)c(O)c1C(C)(C)C |
| InChI | InChI=1S/C25H42O3S/c1-9-11-12-13-14-15-16-29-22-18(23(27)28)17(10-2)19(24(3,4)5)21(26)20(22)25(6,7)8/h26H,9-16H2,1-8H3,(H,27,28) |
| InChIKey | NQRXOLTWUVWKIO-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|