C16H23F2N3O4S — CID 87699523
2-[[4-(2,4-difluorophenyl)piperazin-1-yl]sulfonylmethyl]-N-hydroxy-3-methylbutanamide (PubChem CID 87699523) has the molecular formula C16H23F2N3O4S and a molecular weight of 391.44 g/mol. Its IUPAC name is 2-[[4-(2,4-difluorophenyl)piperazin-1-yl]sulfonylmethyl]-N-hydroxy-3-methylbutanamide.
| Compound Name | 2-[[4-(2,4-difluorophenyl)piperazin-1-yl]sulfonylmethyl]-N-hydroxy-3-methylbutanamide |
|---|---|
| PubChem CID | 87699523 |
| Molecular Formula | C16H23F2N3O4S |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 2-[[4-(2,4-difluorophenyl)piperazin-1-yl]sulfonylmethyl]-N-hydroxy-3-methylbutanamide |
| SMILES | CC(C)C(CS(=O)(=O)N1CCN(c2ccc(F)cc2F)CC1)C(=O)NO |
| InChI | InChI=1S/C16H23F2N3O4S/c1-11(2)13(16(22)19-23)10-26(24,25)21-7-5-20(6-8-21)15-4-3-12(17)9-14(15)18/h3-4,9,11,13,23H,5-8,10H2,1-2H3,(H,19,22) |
| InChIKey | RCJDYWVXNIBNDJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|