C31H37FN2O7S — CID 87704018
[3-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl-piperidin-4-ylcarbamoyl]-5-methoxyphenyl] methanesulfonate (PubChem CID 87704018) has the molecular formula C31H37FN2O7S and a molecular weight of 600.71 g/mol. Its IUPAC name is [3-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl-piperidin-4-ylcarbamoyl]-5-methoxyphenyl] methanesulfonate.
| Compound Name | [3-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl-piperidin-4-ylcarbamoyl]-5-methoxyphenyl] methanesulfonate |
|---|---|
| PubChem CID | 87704018 |
| Molecular Formula | C31H37FN2O7S |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | [3-[[3,5-diethoxy-4-(4-fluorophenyl)phenyl]methyl-piperidin-4-ylcarbamoyl]-5-methoxyphenyl] methanesulfonate |
| SMILES | CCOc1cc(CN(C(=O)c2cc(OC)cc(OS(C)(=O)=O)c2)C2CCNCC2)cc(OCC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C31H37FN2O7S/c1-5-39-28-15-21(16-29(40-6-2)30(28)22-7-9-24(32)10-8-22)20-34(25-11-13-33-14-12-25)31(35)23-17-26(38-3)19-27(18-23)41-42(4,36)37/h7-10,15-19,25,33H,5-6,11-14,20H2,1-4H3 |
| InChIKey | MAJKGEOFNFCQGK-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|