C25H37N3O9 — CID 87709951
[(6R,10R,13S)-3-(2-aminoethoxyimino)-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl] nitrate;(E)-but-2-enedioic acid (PubChem CID 87709951) has the molecular formula C25H37N3O9 and a molecular weight of 523.58 g/mol. Its IUPAC name is [(6R,10R,13S)-3-(2-aminoethoxyimino)-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl] nitrate;(E)-but-2-enedioic acid.
| Compound Name | [(6R,10R,13S)-3-(2-aminoethoxyimino)-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl] nitrate;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 87709951 |
| Molecular Formula | C25H37N3O9 |
| Molecular Weight | 523.58 g/mol |
| Exact Mass | 523.25 |
| IUPAC Name | [(6R,10R,13S)-3-(2-aminoethoxyimino)-10,13-dimethyl-17-oxo-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-6-yl] nitrate;(E)-but-2-enedioic acid |
| SMILES | C[C@]12CCC(=NOCCN)CC1[C@H](O[N+](=O)[O-])CC1C2CC[C@]2(C)C(=O)CCC12.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C21H33N3O5.C4H4O4/c1-20-7-5-13(23-28-10-9-22)11-17(20)18(29-24(26)27)12-14-15-3-4-19(25)21(15,2)8-6-16(14)20;5-3(6)1-2-4(7)8/h14-18H,3-12,22H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/t14?,15?,16?,17?,18-,20-,21+;/m1./s1 |
| InChIKey | ALFLWYDYMGRQRZ-KMDRMIDPSA-N |
| XLogP | 2.83 |
| TPSA | 191.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.58 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|