C15H26N4O4S — CID 87710521
2-amino-2-(heptan-4-ylsulfonylmethyl)-4-(1H-imidazol-5-yl)-3-oxobutanamide (PubChem CID 87710521) has the molecular formula C15H26N4O4S and a molecular weight of 358.46 g/mol. Its IUPAC name is 2-amino-2-(heptan-4-ylsulfonylmethyl)-4-(1H-imidazol-5-yl)-3-oxobutanamide.
| Compound Name | 2-amino-2-(heptan-4-ylsulfonylmethyl)-4-(1H-imidazol-5-yl)-3-oxobutanamide |
|---|---|
| PubChem CID | 87710521 |
| Molecular Formula | C15H26N4O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 2-amino-2-(heptan-4-ylsulfonylmethyl)-4-(1H-imidazol-5-yl)-3-oxobutanamide |
| SMILES | CCCC(CCC)S(=O)(=O)CC(N)(C(N)=O)C(=O)Cc1cnc[nH]1 |
| InChI | InChI=1S/C15H26N4O4S/c1-3-5-12(6-4-2)24(22,23)9-15(17,14(16)21)13(20)7-11-8-18-10-19-11/h8,10,12H,3-7,9,17H2,1-2H3,(H2,16,21)(H,18,19) |
| InChIKey | OBIIKCAIYHLFPS-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 149.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|