C17H26O4 — CID 87710609
2-[3-(cyclobuten-1-yloxy)-3-oxopropylidene]-4-ethyloctanoic acid (PubChem CID 87710609) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 2-[3-(cyclobuten-1-yloxy)-3-oxopropylidene]-4-ethyloctanoic acid.
| Compound Name | 2-[3-(cyclobuten-1-yloxy)-3-oxopropylidene]-4-ethyloctanoic acid |
|---|---|
| PubChem CID | 87710609 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 2-[3-(cyclobuten-1-yloxy)-3-oxopropylidene]-4-ethyloctanoic acid |
| SMILES | CCCCC(CC)CC(=CCC(=O)OC1=CCC1)C(=O)O |
| InChI | InChI=1S/C17H26O4/c1-3-5-7-13(4-2)12-14(17(19)20)10-11-16(18)21-15-8-6-9-15/h8,10,13H,3-7,9,11-12H2,1-2H3,(H,19,20) |
| InChIKey | ZUZRRTZYUOJMPY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|