C32H31F2N7O4S — CID 87710743
[N-(2,6-difluorophenyl)sulfonyl-4-[[6-[1-[2-(4-methylpiperazin-1-yl)ethyl]indol-5-yl]pyrimidin-4-yl]amino]anilino] formate (PubChem CID 87710743) has the molecular formula C32H31F2N7O4S and a molecular weight of 647.71 g/mol. Its IUPAC name is [N-(2,6-difluorophenyl)sulfonyl-4-[[6-[1-[2-(4-methylpiperazin-1-yl)ethyl]indol-5-yl]pyrimidin-4-yl]amino]anilino] formate.
| Compound Name | [N-(2,6-difluorophenyl)sulfonyl-4-[[6-[1-[2-(4-methylpiperazin-1-yl)ethyl]indol-5-yl]pyrimidin-4-yl]amino]anilino] formate |
|---|---|
| PubChem CID | 87710743 |
| Molecular Formula | C32H31F2N7O4S |
| Molecular Weight | 647.71 g/mol |
| Exact Mass | 647.21 |
| IUPAC Name | [N-(2,6-difluorophenyl)sulfonyl-4-[[6-[1-[2-(4-methylpiperazin-1-yl)ethyl]indol-5-yl]pyrimidin-4-yl]amino]anilino] formate |
| SMILES | CN1CCN(CCn2ccc3cc(-c4cc(Nc5ccc(N(OC=O)S(=O)(=O)c6c(F)cccc6F)cc5)ncn4)ccc32)CC1 |
| InChI | InChI=1S/C32H31F2N7O4S/c1-38-13-15-39(16-14-38)17-18-40-12-11-24-19-23(5-10-30(24)40)29-20-31(36-21-35-29)37-25-6-8-26(9-7-25)41(45-22-42)46(43,44)32-27(33)3-2-4-28(32)34/h2-12,19-22H,13-18H2,1H3,(H,35,36,37) |
| InChIKey | RYASKUGAEQZGLY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.71 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|