C32H31FN6O4S — CID 87710280
[N-(2-fluoro-4-methylphenyl)sulfonyl-4-[[6-[1-(2-pyrrolidin-1-ylethyl)indol-5-yl]pyrimidin-4-yl]amino]anilino] formate (PubChem CID 87710280) has the molecular formula C32H31FN6O4S and a molecular weight of 614.70 g/mol. Its IUPAC name is [N-(2-fluoro-4-methylphenyl)sulfonyl-4-[[6-[1-(2-pyrrolidin-1-ylethyl)indol-5-yl]pyrimidin-4-yl]amino]anilino] formate.
| Compound Name | [N-(2-fluoro-4-methylphenyl)sulfonyl-4-[[6-[1-(2-pyrrolidin-1-ylethyl)indol-5-yl]pyrimidin-4-yl]amino]anilino] formate |
|---|---|
| PubChem CID | 87710280 |
| Molecular Formula | C32H31FN6O4S |
| Molecular Weight | 614.70 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | [N-(2-fluoro-4-methylphenyl)sulfonyl-4-[[6-[1-(2-pyrrolidin-1-ylethyl)indol-5-yl]pyrimidin-4-yl]amino]anilino] formate |
| SMILES | Cc1ccc(S(=O)(=O)N(OC=O)c2ccc(Nc3cc(-c4ccc5c(ccn5CCN5CCCC5)c4)ncn3)cc2)c(F)c1 |
| InChI | InChI=1S/C32H31FN6O4S/c1-23-4-11-31(28(33)18-23)44(41,42)39(43-22-40)27-8-6-26(7-9-27)36-32-20-29(34-21-35-32)24-5-10-30-25(19-24)12-15-38(30)17-16-37-13-2-3-14-37/h4-12,15,18-22H,2-3,13-14,16-17H2,1H3,(H,34,35,36) |
| InChIKey | SZUJNSWGIQGAIN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.70 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|