C33H37FN6O2S — CID 69135880
N-[4-[[6-[1-[4-(diethylamino)butyl]indol-5-yl]pyrimidin-4-yl]amino]phenyl]-2-fluoro-4-methylbenzenesulfonamide (PubChem CID 69135880) has the molecular formula C33H37FN6O2S and a molecular weight of 600.76 g/mol. Its IUPAC name is N-[4-[[6-[1-[4-(diethylamino)butyl]indol-5-yl]pyrimidin-4-yl]amino]phenyl]-2-fluoro-4-methylbenzenesulfonamide.
| Compound Name | N-[4-[[6-[1-[4-(diethylamino)butyl]indol-5-yl]pyrimidin-4-yl]amino]phenyl]-2-fluoro-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 69135880 |
| Molecular Formula | C33H37FN6O2S |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.27 |
| IUPAC Name | N-[4-[[6-[1-[4-(diethylamino)butyl]indol-5-yl]pyrimidin-4-yl]amino]phenyl]-2-fluoro-4-methylbenzenesulfonamide |
| SMILES | CCN(CC)CCCCn1ccc2cc(-c3cc(Nc4ccc(NS(=O)(=O)c5ccc(C)cc5F)cc4)ncn3)ccc21 |
| InChI | InChI=1S/C33H37FN6O2S/c1-4-39(5-2)17-6-7-18-40-19-16-26-21-25(9-14-31(26)40)30-22-33(36-23-35-30)37-27-10-12-28(13-11-27)38-43(41,42)32-15-8-24(3)20-29(32)34/h8-16,19-23,38H,4-7,17-18H2,1-3H3,(H,35,36,37) |
| InChIKey | JOWQXDQDRPDGPP-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|