C10H11F7O2 — CID 87711267
(E)-1-butoxy-4,4,5,5,6,6,6-heptafluorohex-1-en-3-one (PubChem CID 87711267) has the molecular formula C10H11F7O2 and a molecular weight of 296.18 g/mol. Its IUPAC name is (E)-1-butoxy-4,4,5,5,6,6,6-heptafluorohex-1-en-3-one.
| Compound Name | (E)-1-butoxy-4,4,5,5,6,6,6-heptafluorohex-1-en-3-one |
|---|---|
| PubChem CID | 87711267 |
| Molecular Formula | C10H11F7O2 |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | (E)-1-butoxy-4,4,5,5,6,6,6-heptafluorohex-1-en-3-one |
| SMILES | CCCCO/C=C/C(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H11F7O2/c1-2-3-5-19-6-4-7(18)8(11,12)9(13,14)10(15,16)17/h4,6H,2-3,5H2,1H3/b6-4+ |
| InChIKey | JWBAXUBIVWHXOS-GQCTYLIASA-N |
| XLogP | 3.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|