C8H14O5S — CID 87713325
ethyl (Z)-3-(2,3-dihydroxypropylsulfanyl)-2-hydroxyprop-2-enoate (PubChem CID 87713325) has the molecular formula C8H14O5S and a molecular weight of 222.26 g/mol. Its IUPAC name is ethyl (Z)-3-(2,3-dihydroxypropylsulfanyl)-2-hydroxyprop-2-enoate.
| Compound Name | ethyl (Z)-3-(2,3-dihydroxypropylsulfanyl)-2-hydroxyprop-2-enoate |
|---|---|
| PubChem CID | 87713325 |
| Molecular Formula | C8H14O5S |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.06 |
| IUPAC Name | ethyl (Z)-3-(2,3-dihydroxypropylsulfanyl)-2-hydroxyprop-2-enoate |
| SMILES | CCOC(=O)/C(O)=C/SCC(O)CO |
| InChI | InChI=1S/C8H14O5S/c1-2-13-8(12)7(11)5-14-4-6(10)3-9/h5-6,9-11H,2-4H2,1H3/b7-5- |
| InChIKey | MUIRHYVHKOFBMY-ALCCZGGFSA-N |
| XLogP | 0.04 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|