C11H20NO6P — CID 87714342
methyl 2-(cyclopentanecarbonylamino)-2-dimethoxyphosphorylacetate (PubChem CID 87714342) has the molecular formula C11H20NO6P and a molecular weight of 293.26 g/mol. Its IUPAC name is methyl 2-(cyclopentanecarbonylamino)-2-dimethoxyphosphorylacetate.
| Compound Name | methyl 2-(cyclopentanecarbonylamino)-2-dimethoxyphosphorylacetate |
|---|---|
| PubChem CID | 87714342 |
| Molecular Formula | C11H20NO6P |
| Molecular Weight | 293.26 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | methyl 2-(cyclopentanecarbonylamino)-2-dimethoxyphosphorylacetate |
| SMILES | COC(=O)C(NC(=O)C1CCCC1)P(=O)(OC)OC |
| InChI | InChI=1S/C11H20NO6P/c1-16-11(14)10(19(15,17-2)18-3)12-9(13)8-6-4-5-7-8/h8,10H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | YAAQZLUPIBDEDW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|