C15H27N2O6P — CID 21440720
bis(cyclohexanecarbonylamino) methyl phosphate (PubChem CID 21440720) has the molecular formula C15H27N2O6P and a molecular weight of 362.36 g/mol. Its IUPAC name is bis(cyclohexanecarbonylamino) methyl phosphate.
| Compound Name | bis(cyclohexanecarbonylamino) methyl phosphate |
|---|---|
| PubChem CID | 21440720 |
| Molecular Formula | C15H27N2O6P |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | bis(cyclohexanecarbonylamino) methyl phosphate |
| SMILES | COP(=O)(ONC(=O)C1CCCCC1)ONC(=O)C1CCCCC1 |
| InChI | InChI=1S/C15H27N2O6P/c1-21-24(20,22-16-14(18)12-8-4-2-5-9-12)23-17-15(19)13-10-6-3-7-11-13/h12-13H,2-11H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | PYKWPESPGNYKHP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|