C21H26ClN3OS — CID 8771559
(2R)-N-(3-chlorophenyl)-2-[2-phenylethylcarbamothioyl(propyl)amino]propanamide (PubChem CID 8771559) has the molecular formula C21H26ClN3OS and a molecular weight of 403.98 g/mol. Its IUPAC name is (2R)-N-(3-chlorophenyl)-2-[2-phenylethylcarbamothioyl(propyl)amino]propanamide.
| Compound Name | (2R)-N-(3-chlorophenyl)-2-[2-phenylethylcarbamothioyl(propyl)amino]propanamide |
|---|---|
| PubChem CID | 8771559 |
| Molecular Formula | C21H26ClN3OS |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (2R)-N-(3-chlorophenyl)-2-[2-phenylethylcarbamothioyl(propyl)amino]propanamide |
| SMILES | CCCN(C(=S)NCCc1ccccc1)[C@H](C)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H26ClN3OS/c1-3-14-25(21(27)23-13-12-17-8-5-4-6-9-17)16(2)20(26)24-19-11-7-10-18(22)15-19/h4-11,15-16H,3,12-14H2,1-2H3,(H,23,27)(H,24,26)/t16-/m1/s1 |
| InChIKey | YOPVDCLJNQEUHQ-MRXNPFEDSA-N |
| XLogP | 4.50 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|