C21H26ClN3OS — CID 8682083
(2R)-N-(3-chlorophenyl)-2-[(4-ethylphenyl)carbamothioyl-propylamino]propanamide (PubChem CID 8682083) has the molecular formula C21H26ClN3OS and a molecular weight of 403.98 g/mol. Its IUPAC name is (2R)-N-(3-chlorophenyl)-2-[(4-ethylphenyl)carbamothioyl-propylamino]propanamide.
| Compound Name | (2R)-N-(3-chlorophenyl)-2-[(4-ethylphenyl)carbamothioyl-propylamino]propanamide |
|---|---|
| PubChem CID | 8682083 |
| Molecular Formula | C21H26ClN3OS |
| Molecular Weight | 403.98 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (2R)-N-(3-chlorophenyl)-2-[(4-ethylphenyl)carbamothioyl-propylamino]propanamide |
| SMILES | CCCN(C(=S)Nc1ccc(CC)cc1)[C@H](C)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H26ClN3OS/c1-4-13-25(21(27)24-18-11-9-16(5-2)10-12-18)15(3)20(26)23-19-8-6-7-17(22)14-19/h6-12,14-15H,4-5,13H2,1-3H3,(H,23,26)(H,24,27)/t15-/m1/s1 |
| InChIKey | DYOXDRDQSUVAML-OAHLLOKOSA-N |
| XLogP | 5.34 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.98 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|