C22H21N5O — CID 87717706
(2R)-1-N-[6-(furan-3-yl)-5-(3-methyl-2H-indazol-5-yl)-3-pyridinyl]pent-4-yne-1,2-diamine (PubChem CID 87717706) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is (2R)-1-N-[6-(furan-3-yl)-5-(3-methyl-2H-indazol-5-yl)-3-pyridinyl]pent-4-yne-1,2-diamine.
| Compound Name | (2R)-1-N-[6-(furan-3-yl)-5-(3-methyl-2H-indazol-5-yl)-3-pyridinyl]pent-4-yne-1,2-diamine |
|---|---|
| PubChem CID | 87717706 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | (2R)-1-N-[6-(furan-3-yl)-5-(3-methyl-2H-indazol-5-yl)-3-pyridinyl]pent-4-yne-1,2-diamine |
| SMILES | C#CC[C@@H](N)CNc1cnc(-c2ccoc2)c(-c2ccc3n[nH]c(C)c3c2)c1 |
| InChI | InChI=1S/C22H21N5O/c1-3-4-17(23)11-24-18-10-20(22(25-12-18)16-7-8-28-13-16)15-5-6-21-19(9-15)14(2)26-27-21/h1,5-10,12-13,17,24H,4,11,23H2,2H3,(H,26,27)/t17-/m1/s1 |
| InChIKey | FEVYZCZGRQCDBP-QGZVFWFLSA-N |
| XLogP | 3.96 |
| TPSA | 92.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|