C23H27F4N3O3 — CID 87719877
N-[4-[4-fluoro-3-[[[4-(methylamino)cyclohexyl]amino]methyl]phenyl]phenyl]formamide;2,2,2-trifluoroacetic acid (PubChem CID 87719877) has the molecular formula C23H27F4N3O3 and a molecular weight of 469.48 g/mol. Its IUPAC name is N-[4-[4-fluoro-3-[[[4-(methylamino)cyclohexyl]amino]methyl]phenyl]phenyl]formamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[4-[4-fluoro-3-[[[4-(methylamino)cyclohexyl]amino]methyl]phenyl]phenyl]formamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87719877 |
| Molecular Formula | C23H27F4N3O3 |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[4-[4-fluoro-3-[[[4-(methylamino)cyclohexyl]amino]methyl]phenyl]phenyl]formamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC1CCC(NCc2cc(-c3ccc(NC=O)cc3)ccc2F)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H26FN3O.C2HF3O2/c1-23-18-7-9-19(10-8-18)24-13-17-12-16(4-11-21(17)22)15-2-5-20(6-3-15)25-14-26;3-2(4,5)1(6)7/h2-6,11-12,14,18-19,23-24H,7-10,13H2,1H3,(H,25,26);(H,6,7) |
| InChIKey | GPYKUNGJVUEDFP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|