C19H18BrFN2O4S2 — CID 87719883
[4-[4-(3-bromo-4-fluorophenyl)-5-oxo-3-propyl-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate (PubChem CID 87719883) has the molecular formula C19H18BrFN2O4S2 and a molecular weight of 501.40 g/mol. Its IUPAC name is [4-[4-(3-bromo-4-fluorophenyl)-5-oxo-3-propyl-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate.
| Compound Name | [4-[4-(3-bromo-4-fluorophenyl)-5-oxo-3-propyl-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 87719883 |
| Molecular Formula | C19H18BrFN2O4S2 |
| Molecular Weight | 501.40 g/mol |
| Exact Mass | 499.99 |
| IUPAC Name | [4-[4-(3-bromo-4-fluorophenyl)-5-oxo-3-propyl-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate |
| SMILES | CCCN1C(=S)NC(=O)C1(c1ccc(OS(C)(=O)=O)cc1)c1ccc(F)c(Br)c1 |
| InChI | InChI=1S/C19H18BrFN2O4S2/c1-3-10-23-18(28)22-17(24)19(23,13-6-9-16(21)15(20)11-13)12-4-7-14(8-5-12)27-29(2,25)26/h4-9,11H,3,10H2,1-2H3,(H,22,24,28) |
| InChIKey | NDCJJSLASXANKX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|