C17H14BrFN2O4S2 — CID 87720044
[4-[4-[(3-bromo-4-fluorophenyl)methyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate (PubChem CID 87720044) has the molecular formula C17H14BrFN2O4S2 and a molecular weight of 473.35 g/mol. Its IUPAC name is [4-[4-[(3-bromo-4-fluorophenyl)methyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate.
| Compound Name | [4-[4-[(3-bromo-4-fluorophenyl)methyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 87720044 |
| Molecular Formula | C17H14BrFN2O4S2 |
| Molecular Weight | 473.35 g/mol |
| Exact Mass | 471.96 |
| IUPAC Name | [4-[4-[(3-bromo-4-fluorophenyl)methyl]-5-oxo-2-sulfanylideneimidazolidin-4-yl]phenyl] methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc(C2(Cc3ccc(F)c(Br)c3)NC(=S)NC2=O)cc1 |
| InChI | InChI=1S/C17H14BrFN2O4S2/c1-27(23,24)25-12-5-3-11(4-6-12)17(15(22)20-16(26)21-17)9-10-2-7-14(19)13(18)8-10/h2-8H,9H2,1H3,(H2,20,21,22,26) |
| InChIKey | BPQBGOGPYFGMGI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|