C16H13FN2O2 — CID 87720226
2-[(3-fluorophenyl)methyl]-N-hydroxy-1H-indole-6-carboxamide (PubChem CID 87720226) has the molecular formula C16H13FN2O2 and a molecular weight of 284.29 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-N-hydroxy-1H-indole-6-carboxamide.
| Compound Name | 2-[(3-fluorophenyl)methyl]-N-hydroxy-1H-indole-6-carboxamide |
|---|---|
| PubChem CID | 87720226 |
| Molecular Formula | C16H13FN2O2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-N-hydroxy-1H-indole-6-carboxamide |
| SMILES | O=C(NO)c1ccc2cc(Cc3cccc(F)c3)[nH]c2c1 |
| InChI | InChI=1S/C16H13FN2O2/c17-13-3-1-2-10(6-13)7-14-8-11-4-5-12(16(20)19-21)9-15(11)18-14/h1-6,8-9,18,21H,7H2,(H,19,20) |
| InChIKey | WMTFLIQGPOEZPB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|