C18H16FNO2 — CID 155598518
3-(cyclodecapentaenylmethyl)-5-fluoro-N-hydroxybenzamide (PubChem CID 155598518) has the molecular formula C18H16FNO2 and a molecular weight of 297.33 g/mol. Its IUPAC name is 3-(cyclodecapentaenylmethyl)-5-fluoro-N-hydroxybenzamide.
| Compound Name | 3-(cyclodecapentaenylmethyl)-5-fluoro-N-hydroxybenzamide |
|---|---|
| PubChem CID | 155598518 |
| Molecular Formula | C18H16FNO2 |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 3-(cyclodecapentaenylmethyl)-5-fluoro-N-hydroxybenzamide |
| SMILES | O=C(NO)c1cc(F)cc(Cc2ccccccccc2)c1 |
| InChI | InChI=1S/C18H16FNO2/c19-17-12-15(11-16(13-17)18(21)20-22)10-14-8-6-4-2-1-3-5-7-9-14/h1-9,11-13,22H,10H2,(H,20,21)/b2-1-,3-1-,4-2-,5-3+,6-4+,7-5+,8-6+,9-7-,14-8+,14-9+ |
| InChIKey | OAXPLSMXZKSBAC-VAENZKFOSA-N |
| XLogP | 3.66 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|