C38H40MoO8 — CID 87721865
2-(2-methylbutoxy)-9H-xanthene-1-carboxylic acid;molybdenum;2-pentoxy-9H-xanthene-1-carboxylic acid (PubChem CID 87721865) has the molecular formula C38H40MoO8 and a molecular weight of 720.67 g/mol. Its IUPAC name is 2-(2-methylbutoxy)-9H-xanthene-1-carboxylic acid;molybdenum;2-pentoxy-9H-xanthene-1-carboxylic acid.
| Compound Name | 2-(2-methylbutoxy)-9H-xanthene-1-carboxylic acid;molybdenum;2-pentoxy-9H-xanthene-1-carboxylic acid |
|---|---|
| PubChem CID | 87721865 |
| Molecular Formula | C38H40MoO8 |
| Molecular Weight | 720.67 g/mol |
| Exact Mass | 722.18 |
| IUPAC Name | 2-(2-methylbutoxy)-9H-xanthene-1-carboxylic acid;molybdenum;2-pentoxy-9H-xanthene-1-carboxylic acid |
| SMILES | CCC(C)COc1ccc2c(c1C(=O)O)Cc1ccccc1O2.CCCCCOc1ccc2c(c1C(=O)O)Cc1ccccc1O2.[Mo] |
| InChI | InChI=1S/2C19H20O4.Mo/c1-3-12(2)11-22-17-9-8-16-14(18(17)19(20)21)10-13-6-4-5-7-15(13)23-16;1-2-3-6-11-22-17-10-9-16-14(18(17)19(20)21)12-13-7-4-5-8-15(13)23-16;/h4-9,12H,3,10-11H2,1-2H3,(H,20,21);4-5,7-10H,2-3,6,11-12H2,1H3,(H,20,21); |
| InChIKey | UKJHKFJNTCNDJD-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.67 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|