C28H35F4N3O3 — CID 87723221
N-[(3S,4R,5R)-3-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-5-(3-hydroxybenzoyl)piperidin-3-yl]-N-(2,2,2-trifluoroethyl)formamide (PubChem CID 87723221) has the molecular formula C28H35F4N3O3 and a molecular weight of 537.60 g/mol. Its IUPAC name is N-[(3S,4R,5R)-3-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-5-(3-hydroxybenzoyl)piperidin-3-yl]-N-(2,2,2-trifluoroethyl)formamide.
| Compound Name | N-[(3S,4R,5R)-3-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-5-(3-hydroxybenzoyl)piperidin-3-yl]-N-(2,2,2-trifluoroethyl)formamide |
|---|---|
| PubChem CID | 87723221 |
| Molecular Formula | C28H35F4N3O3 |
| Molecular Weight | 537.60 g/mol |
| Exact Mass | 537.26 |
| IUPAC Name | N-[(3S,4R,5R)-3-[4-(dimethylamino)butyl]-4-(3-fluoro-2-methylphenyl)-5-(3-hydroxybenzoyl)piperidin-3-yl]-N-(2,2,2-trifluoroethyl)formamide |
| SMILES | Cc1c(F)cccc1[C@H]1[C@@H](C(=O)c2cccc(O)c2)CNC[C@@]1(CCCCN(C)C)N(C=O)CC(F)(F)F |
| InChI | InChI=1S/C28H35F4N3O3/c1-19-22(10-7-11-24(19)29)25-23(26(38)20-8-6-9-21(37)14-20)15-33-16-27(25,12-4-5-13-34(2)3)35(18-36)17-28(30,31)32/h6-11,14,18,23,25,33,37H,4-5,12-13,15-17H2,1-3H3/t23-,25-,27+/m0/s1 |
| InChIKey | PUHQWXPQCQUEQI-SCTDOJESSA-N |
| XLogP | 4.52 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.60 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|