About 2,2-bis(furan-2-yl)acetyl chloride
2,2-bis(furan-2-yl)acetyl chloride (PubChem CID 87723454) has the molecular formula C10H7ClO3
and a molecular weight of 210.62 g/mol. Its IUPAC name is 2,2-bis(furan-2-yl)acetyl chloride.
Molecular Properties
| Compound Name | 2,2-bis(furan-2-yl)acetyl chloride |
| PubChem CID | 87723454 |
| Molecular Formula | C10H7ClO3 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.01 |
| IUPAC Name | 2,2-bis(furan-2-yl)acetyl chloride |
| SMILES | O=C(Cl)C(c1ccco1)c1ccco1 |
| InChI | InChI=1S/C10H7ClO3/c11-10(12)9(7-3-1-5-13-7)8-4-2-6-14-8/h1-6,9H |
| InChIKey | UHRSAQUVFSXNSM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(furan-2-yl)acetyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(furan-2-yl)acetyl chloride?
The IUPAC name of 2,2-bis(furan-2-yl)acetyl chloride (CID 87723454) is 2,2-bis(furan-2-yl)acetyl chloride.
What is the SMILES notation for 2,2-bis(furan-2-yl)acetyl chloride?
The canonical SMILES for 2,2-bis(furan-2-yl)acetyl chloride is O=C(Cl)C(c1ccco1)c1ccco1.
What is the InChIKey of 2,2-bis(furan-2-yl)acetyl chloride?
The InChIKey is UHRSAQUVFSXNSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7ClO3/c11-10(12)9(7-3-1-5-13-7)8-4-2-6-14-8/h1-6,9H.
What are the key properties of 2,2-bis(furan-2-yl)acetyl chloride?
2,2-bis(furan-2-yl)acetyl chloride has a molecular weight of 210.62 g/mol, XLogP of 2.77, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(furan-2-yl)acetyl chloride is sourced from PubChem (CID 87723454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).