C21H18N2O4 — CID 87726402
methyl 3-formyl-6-[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]-1H-indole-4-carboxylate (PubChem CID 87726402) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is methyl 3-formyl-6-[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]-1H-indole-4-carboxylate.
| Compound Name | methyl 3-formyl-6-[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]-1H-indole-4-carboxylate |
|---|---|
| PubChem CID | 87726402 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | methyl 3-formyl-6-[[(1R,2R)-2-phenylcyclopropanecarbonyl]amino]-1H-indole-4-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)[C@@H]2C[C@H]2c2ccccc2)cc2[nH]cc(C=O)c12 |
| InChI | InChI=1S/C21H18N2O4/c1-27-21(26)17-7-14(8-18-19(17)13(11-24)10-22-18)23-20(25)16-9-15(16)12-5-3-2-4-6-12/h2-8,10-11,15-16,22H,9H2,1H3,(H,23,25)/t15-,16+/m0/s1 |
| InChIKey | LEPFDIFSZLPNTL-JKSUJKDBSA-N |
| XLogP | 3.51 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|