About [diisocyanato(phenyl)methyl]benzene;2-prop-1-enoxyethanol
[diisocyanato(phenyl)methyl]benzene;2-prop-1-enoxyethanol (PubChem CID 87729354) has the molecular formula C20H20N2O4
and a molecular weight of 352.39 g/mol. Its IUPAC name is [diisocyanato(phenyl)methyl]benzene;2-prop-1-enoxyethanol.
Molecular Properties
| Compound Name | [diisocyanato(phenyl)methyl]benzene;2-prop-1-enoxyethanol |
| PubChem CID | 87729354 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | [diisocyanato(phenyl)methyl]benzene;2-prop-1-enoxyethanol |
| SMILES | CC=COCCO.O=C=NC(N=C=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H10N2O2.C5H10O2/c18-11-16-15(17-12-19,13-7-3-1-4-8-13)14-9-5-2-6-10-14;1-2-4-7-5-3-6/h1-10H;2,4,6H,3,5H2,1H3 |
| InChIKey | NCHLNCUIPLQCRB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze [diisocyanato(phenyl)methyl]benzene;2-prop-1-enoxyethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [diisocyanato(phenyl)methyl]benzene;2-prop-1-enoxyethanol?
The IUPAC name of [diisocyanato(phenyl)methyl]benzene;2-prop-1-enoxyethanol (CID 87729354) is [diisocyanato(phenyl)methyl]benzene;2-prop-1-enoxyethanol.
What is the SMILES notation for [diisocyanato(phenyl)methyl]benzene;2-prop-1-enoxyethanol?
The canonical SMILES for [diisocyanato(phenyl)methyl]benzene;2-prop-1-enoxyethanol is CC=COCCO.O=C=NC(N=C=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of [diisocyanato(phenyl)methyl]benzene;2-prop-1-enoxyethanol?
The InChIKey is NCHLNCUIPLQCRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10N2O2.C5H10O2/c18-11-16-15(17-12-19,13-7-3-1-4-8-13)14-9-5-2-6-10-14;1-2-4-7-5-3-6/h1-10H;2,4,6H,3,5H2,1H3.
What are the key properties of [diisocyanato(phenyl)methyl]benzene;2-prop-1-enoxyethanol?
[diisocyanato(phenyl)methyl]benzene;2-prop-1-enoxyethanol has a molecular weight of 352.39 g/mol, XLogP of 3.09, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [diisocyanato(phenyl)methyl]benzene;2-prop-1-enoxyethanol is sourced from PubChem (CID 87729354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).