C19H20N4O5S — CID 87731449
4-methyl-2-[[(2R,4R)-2-pyridin-2-yl-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl]benzenesulfonic acid (PubChem CID 87731449) has the molecular formula C19H20N4O5S and a molecular weight of 416.46 g/mol. Its IUPAC name is 4-methyl-2-[[(2R,4R)-2-pyridin-2-yl-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl]benzenesulfonic acid.
| Compound Name | 4-methyl-2-[[(2R,4R)-2-pyridin-2-yl-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87731449 |
| Molecular Formula | C19H20N4O5S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 4-methyl-2-[[(2R,4R)-2-pyridin-2-yl-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl]benzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)c(C[C@@H]2CO[C@@](Cn3cncn3)(c3ccccn3)O2)c1 |
| InChI | InChI=1S/C19H20N4O5S/c1-14-5-6-17(29(24,25)26)15(8-14)9-16-10-27-19(28-16,11-23-13-20-12-22-23)18-4-2-3-7-21-18/h2-8,12-13,16H,9-11H2,1H3,(H,24,25,26)/t16-,19-/m1/s1 |
| InChIKey | BMARQQWJVHYJEY-VQIMIIECSA-N |
| XLogP | 1.74 |
| TPSA | 116.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|