C19H20N4O6S — CID 87482314
[(2R,4S)-2-(1-oxidopyridin-1-ium-2-yl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 87482314) has the molecular formula C19H20N4O6S and a molecular weight of 432.46 g/mol. Its IUPAC name is [(2R,4S)-2-(1-oxidopyridin-1-ium-2-yl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,4S)-2-(1-oxidopyridin-1-ium-2-yl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87482314 |
| Molecular Formula | C19H20N4O6S |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | [(2R,4S)-2-(1-oxidopyridin-1-ium-2-yl)-2-(1,2,4-triazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@@H]2CO[C@@](Cn3cncn3)(c3cccc[n+]3[O-])O2)cc1 |
| InChI | InChI=1S/C19H20N4O6S/c1-15-5-7-17(8-6-15)30(25,26)28-11-16-10-27-19(29-16,12-22-14-20-13-21-22)18-4-2-3-9-23(18)24/h2-9,13-14,16H,10-12H2,1H3/t16-,19+/m0/s1 |
| InChIKey | HNFXBFSCZRXCLV-QFBILLFUSA-N |
| XLogP | 0.89 |
| TPSA | 119.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|