C23H28N4O3S2 — CID 87732626
4-[2-[[4-[benzyl(ethyl)amino]-2-methylphenyl]diazenyl]-1,3-thiazol-3-ium-3-yl]butane-1-sulfonate (PubChem CID 87732626) has the molecular formula C23H28N4O3S2 and a molecular weight of 472.64 g/mol. Its IUPAC name is 4-[2-[[4-[benzyl(ethyl)amino]-2-methylphenyl]diazenyl]-1,3-thiazol-3-ium-3-yl]butane-1-sulfonate.
| Compound Name | 4-[2-[[4-[benzyl(ethyl)amino]-2-methylphenyl]diazenyl]-1,3-thiazol-3-ium-3-yl]butane-1-sulfonate |
|---|---|
| PubChem CID | 87732626 |
| Molecular Formula | C23H28N4O3S2 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 4-[2-[[4-[benzyl(ethyl)amino]-2-methylphenyl]diazenyl]-1,3-thiazol-3-ium-3-yl]butane-1-sulfonate |
| SMILES | CCN(Cc1ccccc1)c1ccc(/N=N/c2scc[n+]2CCCCS(=O)(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C23H28N4O3S2/c1-3-26(18-20-9-5-4-6-10-20)21-11-12-22(19(2)17-21)24-25-23-27(14-15-31-23)13-7-8-16-32(28,29)30/h4-6,9-12,14-15,17H,3,7-8,13,16,18H2,1-2H3 |
| InChIKey | MFKUCAYVTSJFLY-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 89.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|