C20H37N3O6S — CID 87734050
(3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione;methanesulfonic acid (PubChem CID 87734050) has the molecular formula C20H37N3O6S and a molecular weight of 447.60 g/mol. Its IUPAC name is (3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione;methanesulfonic acid.
| Compound Name | (3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione;methanesulfonic acid |
|---|---|
| PubChem CID | 87734050 |
| Molecular Formula | C20H37N3O6S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | (3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione;methanesulfonic acid |
| SMILES | CCCCN1C(=O)[C@@H]([C@H](O)C2CCCCC2)NC(=O)C12CCNCC2.CS(=O)(=O)O |
| InChI | InChI=1S/C19H33N3O3.CH4O3S/c1-2-3-13-22-17(24)15(16(23)14-7-5-4-6-8-14)21-18(25)19(22)9-11-20-12-10-19;1-5(2,3)4/h14-16,20,23H,2-13H2,1H3,(H,21,25);1H3,(H,2,3,4)/t15-,16-;/m1./s1 |
| InChIKey | NIKSCDNCECXRLE-QNBGGDODSA-N |
| XLogP | 0.68 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|