C12H7Cl2NO2S — CID 87737222
2-[4-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-oxoacetyl chloride (PubChem CID 87737222) has the molecular formula C12H7Cl2NO2S and a molecular weight of 300.17 g/mol. Its IUPAC name is 2-[4-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-oxoacetyl chloride.
| Compound Name | 2-[4-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-oxoacetyl chloride |
|---|---|
| PubChem CID | 87737222 |
| Molecular Formula | C12H7Cl2NO2S |
| Molecular Weight | 300.17 g/mol |
| Exact Mass | 298.96 |
| IUPAC Name | 2-[4-[(3-chlorophenyl)methyl]-1,3-thiazol-2-yl]-2-oxoacetyl chloride |
| SMILES | O=C(Cl)C(=O)c1nc(Cc2cccc(Cl)c2)cs1 |
| InChI | InChI=1S/C12H7Cl2NO2S/c13-8-3-1-2-7(4-8)5-9-6-18-12(15-9)10(16)11(14)17/h1-4,6H,5H2 |
| InChIKey | ADEKLSHVOVFQAF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.17 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|