C14H10FNO4S — CID 69138404
(Z)-4-[4-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2-hydroxy-4-oxobut-2-enoic acid (PubChem CID 69138404) has the molecular formula C14H10FNO4S and a molecular weight of 307.30 g/mol. Its IUPAC name is (Z)-4-[4-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2-hydroxy-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[4-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2-hydroxy-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 69138404 |
| Molecular Formula | C14H10FNO4S |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.03 |
| IUPAC Name | (Z)-4-[4-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-2-hydroxy-4-oxobut-2-enoic acid |
| SMILES | O=C(O)/C(O)=C/C(=O)c1nc(Cc2cccc(F)c2)cs1 |
| InChI | InChI=1S/C14H10FNO4S/c15-9-3-1-2-8(4-9)5-10-7-21-13(16-10)11(17)6-12(18)14(19)20/h1-4,6-7,18H,5H2,(H,19,20)/b12-6- |
| InChIKey | YAISIVXOJIJQLO-SDQBBNPISA-N |
| XLogP | 2.58 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|