C17H17Cl2FN2OS — CID 8773750
(2S)-N-(2-chloro-4-fluorophenyl)-2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]propanamide (PubChem CID 8773750) has the molecular formula C17H17Cl2FN2OS and a molecular weight of 387.31 g/mol. Its IUPAC name is (2S)-N-(2-chloro-4-fluorophenyl)-2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]propanamide.
| Compound Name | (2S)-N-(2-chloro-4-fluorophenyl)-2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]propanamide |
|---|---|
| PubChem CID | 8773750 |
| Molecular Formula | C17H17Cl2FN2OS |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | (2S)-N-(2-chloro-4-fluorophenyl)-2-[(5-chlorothiophen-2-yl)methyl-prop-2-enylamino]propanamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)[C@@H](C)C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C17H17Cl2FN2OS/c1-3-8-22(10-13-5-7-16(19)24-13)11(2)17(23)21-15-6-4-12(20)9-14(15)18/h3-7,9,11H,1,8,10H2,2H3,(H,21,23)/t11-/m0/s1 |
| InChIKey | GQAUVQDUWGNQTM-NSHDSACASA-N |
| XLogP | 5.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|