C28H29NO5 — CID 87738212
1-(4-methoxyphenyl)-2-[4-(phenylmethoxycarbamoyl)phenyl]cyclohexane-1-carboxylic acid (PubChem CID 87738212) has the molecular formula C28H29NO5 and a molecular weight of 459.54 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2-[4-(phenylmethoxycarbamoyl)phenyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-(4-methoxyphenyl)-2-[4-(phenylmethoxycarbamoyl)phenyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 87738212 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 1-(4-methoxyphenyl)-2-[4-(phenylmethoxycarbamoyl)phenyl]cyclohexane-1-carboxylic acid |
| SMILES | COc1ccc(C2(C(=O)O)CCCCC2c2ccc(C(=O)NOCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C28H29NO5/c1-33-24-16-14-23(15-17-24)28(27(31)32)18-6-5-9-25(28)21-10-12-22(13-11-21)26(30)29-34-19-20-7-3-2-4-8-20/h2-4,7-8,10-17,25H,5-6,9,18-19H2,1H3,(H,29,30)(H,31,32) |
| InChIKey | ZREYTHIMPXPSNH-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|