C28H29NO5 — CID 87731590
(4-methoxyphenyl) 1-[4-(phenylmethoxycarbamoyl)phenyl]cyclohexane-1-carboxylate (PubChem CID 87731590) has the molecular formula C28H29NO5 and a molecular weight of 459.54 g/mol. Its IUPAC name is (4-methoxyphenyl) 1-[4-(phenylmethoxycarbamoyl)phenyl]cyclohexane-1-carboxylate.
| Compound Name | (4-methoxyphenyl) 1-[4-(phenylmethoxycarbamoyl)phenyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 87731590 |
| Molecular Formula | C28H29NO5 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | (4-methoxyphenyl) 1-[4-(phenylmethoxycarbamoyl)phenyl]cyclohexane-1-carboxylate |
| SMILES | COc1ccc(OC(=O)C2(c3ccc(C(=O)NOCc4ccccc4)cc3)CCCCC2)cc1 |
| InChI | InChI=1S/C28H29NO5/c1-32-24-14-16-25(17-15-24)34-27(31)28(18-6-3-7-19-28)23-12-10-22(11-13-23)26(30)29-33-20-21-8-4-2-5-9-21/h2,4-5,8-17H,3,6-7,18-20H2,1H3,(H,29,30) |
| InChIKey | FAKDPXAJJLEYQV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|