C34H33NO5 — CID 58611854
[4-[(E)-C,N-bis(phenylmethoxy)carbonimidoyl]phenyl] 1-(4-hydroxyphenyl)cyclohexane-1-carboxylate (PubChem CID 58611854) has the molecular formula C34H33NO5 and a molecular weight of 535.64 g/mol. Its IUPAC name is [4-[(E)-C,N-bis(phenylmethoxy)carbonimidoyl]phenyl] 1-(4-hydroxyphenyl)cyclohexane-1-carboxylate.
| Compound Name | [4-[(E)-C,N-bis(phenylmethoxy)carbonimidoyl]phenyl] 1-(4-hydroxyphenyl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 58611854 |
| Molecular Formula | C34H33NO5 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | [4-[(E)-C,N-bis(phenylmethoxy)carbonimidoyl]phenyl] 1-(4-hydroxyphenyl)cyclohexane-1-carboxylate |
| SMILES | O=C(Oc1ccc(/C(=N\OCc2ccccc2)OCc2ccccc2)cc1)C1(c2ccc(O)cc2)CCCCC1 |
| InChI | InChI=1S/C34H33NO5/c36-30-18-16-29(17-19-30)34(22-8-3-9-23-34)33(37)40-31-20-14-28(15-21-31)32(38-24-26-10-4-1-5-11-26)35-39-25-27-12-6-2-7-13-27/h1-2,4-7,10-21,36H,3,8-9,22-25H2/b35-32+ |
| InChIKey | PRRQYSXJTDPHHK-LVYIWIAJSA-N |
| XLogP | 7.29 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|