C19H19NO3 — CID 136659029
benzyl 4-hydroxy-N-penta-2,4-dienoxybenzenecarboximidate (PubChem CID 136659029) has the molecular formula C19H19NO3 and a molecular weight of 309.37 g/mol. Its IUPAC name is benzyl 4-hydroxy-N-penta-2,4-dienoxybenzenecarboximidate.
| Compound Name | benzyl 4-hydroxy-N-penta-2,4-dienoxybenzenecarboximidate |
|---|---|
| PubChem CID | 136659029 |
| Molecular Formula | C19H19NO3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | benzyl 4-hydroxy-N-penta-2,4-dienoxybenzenecarboximidate |
| SMILES | C=CC=CCON=C(OCc1ccccc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C19H19NO3/c1-2-3-7-14-23-20-19(17-10-12-18(21)13-11-17)22-15-16-8-5-4-6-9-16/h2-13,21H,1,14-15H2 |
| InChIKey | KEYYDOUJMKJARH-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|