C24H28FN5O4S — CID 87740414
tert-butyl 2-[3-(4-fluorophenyl)-4-[4-(methoxycarbamoyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-yl]piperidine-1-carboxylate (PubChem CID 87740414) has the molecular formula C24H28FN5O4S and a molecular weight of 501.58 g/mol. Its IUPAC name is tert-butyl 2-[3-(4-fluorophenyl)-4-[4-(methoxycarbamoyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 2-[3-(4-fluorophenyl)-4-[4-(methoxycarbamoyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87740414 |
| Molecular Formula | C24H28FN5O4S |
| Molecular Weight | 501.58 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | tert-butyl 2-[3-(4-fluorophenyl)-4-[4-(methoxycarbamoyl)-1,3-thiazol-2-yl]-1H-pyrazol-5-yl]piperidine-1-carboxylate |
| SMILES | CONC(=O)c1csc(-c2c(-c3ccc(F)cc3)n[nH]c2C2CCCCN2C(=O)OC(C)(C)C)n1 |
| InChI | InChI=1S/C24H28FN5O4S/c1-24(2,3)34-23(32)30-12-6-5-7-17(30)20-18(22-26-16(13-35-22)21(31)29-33-4)19(27-28-20)14-8-10-15(25)11-9-14/h8-11,13,17H,5-7,12H2,1-4H3,(H,27,28)(H,29,31) |
| InChIKey | RCGZLKHGUNJCJA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 109.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.58 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|