C18H20ClN3O3 — CID 8774164
(2R)-2-[2-(4-chlorophenoxy)ethylamino]-N-(methylcarbamoyl)-2-phenylacetamide (PubChem CID 8774164) has the molecular formula C18H20ClN3O3 and a molecular weight of 361.83 g/mol. Its IUPAC name is (2R)-2-[2-(4-chlorophenoxy)ethylamino]-N-(methylcarbamoyl)-2-phenylacetamide.
| Compound Name | (2R)-2-[2-(4-chlorophenoxy)ethylamino]-N-(methylcarbamoyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 8774164 |
| Molecular Formula | C18H20ClN3O3 |
| Molecular Weight | 361.83 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (2R)-2-[2-(4-chlorophenoxy)ethylamino]-N-(methylcarbamoyl)-2-phenylacetamide |
| SMILES | CNC(=O)NC(=O)[C@H](NCCOc1ccc(Cl)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H20ClN3O3/c1-20-18(24)22-17(23)16(13-5-3-2-4-6-13)21-11-12-25-15-9-7-14(19)8-10-15/h2-10,16,21H,11-12H2,1H3,(H2,20,22,23,24)/t16-/m1/s1 |
| InChIKey | NAMYJUAGYVQQHV-MRXNPFEDSA-N |
| XLogP | 2.51 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.83 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|