C19H38OS — CID 87744554
2,2,3-tributylheptanethioic S-acid (PubChem CID 87744554) has the molecular formula C19H38OS and a molecular weight of 314.58 g/mol. Its IUPAC name is 2,2,3-tributylheptanethioic S-acid.
| Compound Name | 2,2,3-tributylheptanethioic S-acid |
|---|---|
| PubChem CID | 87744554 |
| Molecular Formula | C19H38OS |
| Molecular Weight | 314.58 g/mol |
| Exact Mass | 314.26 |
| IUPAC Name | 2,2,3-tributylheptanethioic S-acid |
| SMILES | CCCCC(CCCC)C(CCCC)(CCCC)C(=O)S |
| InChI | InChI=1S/C19H38OS/c1-5-9-13-17(14-10-6-2)19(18(20)21,15-11-7-3)16-12-8-4/h17H,5-16H2,1-4H3,(H,20,21) |
| InChIKey | HKRSHPDLWXLHTA-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.58 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|