C21H40N2O4 — CID 53356916
[(2R)-2,5-diamino-5-oxopentanoyl] 2-butyl-2-ethyl-3-propylheptanoate (PubChem CID 53356916) has the molecular formula C21H40N2O4 and a molecular weight of 384.56 g/mol. Its IUPAC name is [(2R)-2,5-diamino-5-oxopentanoyl] 2-butyl-2-ethyl-3-propylheptanoate.
| Compound Name | [(2R)-2,5-diamino-5-oxopentanoyl] 2-butyl-2-ethyl-3-propylheptanoate |
|---|---|
| PubChem CID | 53356916 |
| Molecular Formula | C21H40N2O4 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | [(2R)-2,5-diamino-5-oxopentanoyl] 2-butyl-2-ethyl-3-propylheptanoate |
| SMILES | CCCCC(CCC)C(CC)(CCCC)C(=O)OC(=O)[C@H](N)CCC(N)=O |
| InChI | InChI=1S/C21H40N2O4/c1-5-9-12-16(11-7-3)21(8-4,15-10-6-2)20(26)27-19(25)17(22)13-14-18(23)24/h16-17H,5-15,22H2,1-4H3,(H2,23,24)/t16?,17-,21?/m1/s1 |
| InChIKey | FPMPMBCCMRPNKB-BQIYRTECSA-N |
| XLogP | 3.84 |
| TPSA | 112.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|