C15H36O10S — CID 87747917
ethoxyethane;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;propyl hydrogen sulfate (PubChem CID 87747917) has the molecular formula C15H36O10S and a molecular weight of 408.51 g/mol. Its IUPAC name is ethoxyethane;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;propyl hydrogen sulfate.
| Compound Name | ethoxyethane;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;propyl hydrogen sulfate |
|---|---|
| PubChem CID | 87747917 |
| Molecular Formula | C15H36O10S |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | ethoxyethane;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol;propyl hydrogen sulfate |
| SMILES | CCCOS(=O)(=O)O.CCOCC.OCCOCCOCCOCCO |
| InChI | InChI=1S/C8H18O5.C4H10O.C3H8O4S/c9-1-3-11-5-7-13-8-6-12-4-2-10;1-3-5-4-2;1-2-3-7-8(4,5)6/h9-10H,1-8H2;3-4H2,1-2H3;2-3H2,1H3,(H,4,5,6) |
| InChIKey | KUIOXVFGKZXMHA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|