C18H42O10S — CID 87749418
ethoxyethane;hexyl hydrogen sulfate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol (PubChem CID 87749418) has the molecular formula C18H42O10S and a molecular weight of 450.59 g/mol. Its IUPAC name is ethoxyethane;hexyl hydrogen sulfate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol.
| Compound Name | ethoxyethane;hexyl hydrogen sulfate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 87749418 |
| Molecular Formula | C18H42O10S |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.25 |
| IUPAC Name | ethoxyethane;hexyl hydrogen sulfate;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol |
| SMILES | CCCCCCOS(=O)(=O)O.CCOCC.OCCOCCOCCOCCO |
| InChI | InChI=1S/C8H18O5.C6H14O4S.C4H10O/c9-1-3-11-5-7-13-8-6-12-4-2-10;1-2-3-4-5-6-10-11(7,8)9;1-3-5-4-2/h9-10H,1-8H2;2-6H2,1H3,(H,7,8,9);3-4H2,1-2H3 |
| InChIKey | GLIQXGSLAPCFRA-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|