C24H28ClFN6O2 — CID 87751067
N-[1-(4-chloro-2-fluorophenyl)propyl]-1-ethyl-4-[(4-hydroxyiminocyclohexyl)amino]pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 87751067) has the molecular formula C24H28ClFN6O2 and a molecular weight of 486.98 g/mol. Its IUPAC name is N-[1-(4-chloro-2-fluorophenyl)propyl]-1-ethyl-4-[(4-hydroxyiminocyclohexyl)amino]pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | N-[1-(4-chloro-2-fluorophenyl)propyl]-1-ethyl-4-[(4-hydroxyiminocyclohexyl)amino]pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 87751067 |
| Molecular Formula | C24H28ClFN6O2 |
| Molecular Weight | 486.98 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-[1-(4-chloro-2-fluorophenyl)propyl]-1-ethyl-4-[(4-hydroxyiminocyclohexyl)amino]pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CCC(NC(=O)c1cnc2c(cnn2CC)c1NC1CCC(=NO)CC1)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C24H28ClFN6O2/c1-3-21(17-10-5-14(25)11-20(17)26)30-24(33)19-12-27-23-18(13-28-32(23)4-2)22(19)29-15-6-8-16(31-34)9-7-15/h5,10-13,15,21,34H,3-4,6-9H2,1-2H3,(H,27,29)(H,30,33)/b31-16- |
| InChIKey | PRRIYDOHEIGYDT-ACXHZZMFSA-N |
| XLogP | 5.31 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.98 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|