C25H32N6O2 — CID 87751191
N-[1-(2,4-dimethylphenyl)ethyl]-1-ethyl-4-[(4-hydroxyiminocyclohexyl)amino]pyrazolo[3,4-b]pyridine-5-carboxamide (PubChem CID 87751191) has the molecular formula C25H32N6O2 and a molecular weight of 448.57 g/mol. Its IUPAC name is N-[1-(2,4-dimethylphenyl)ethyl]-1-ethyl-4-[(4-hydroxyiminocyclohexyl)amino]pyrazolo[3,4-b]pyridine-5-carboxamide.
| Compound Name | N-[1-(2,4-dimethylphenyl)ethyl]-1-ethyl-4-[(4-hydroxyiminocyclohexyl)amino]pyrazolo[3,4-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 87751191 |
| Molecular Formula | C25H32N6O2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.26 |
| IUPAC Name | N-[1-(2,4-dimethylphenyl)ethyl]-1-ethyl-4-[(4-hydroxyiminocyclohexyl)amino]pyrazolo[3,4-b]pyridine-5-carboxamide |
| SMILES | CCn1ncc2c(NC3CCC(=NO)CC3)c(C(=O)NC(C)c3ccc(C)cc3C)cnc21 |
| InChI | InChI=1S/C25H32N6O2/c1-5-31-24-21(14-27-31)23(29-18-7-9-19(30-33)10-8-18)22(13-26-24)25(32)28-17(4)20-11-6-15(2)12-16(20)3/h6,11-14,17-18,33H,5,7-10H2,1-4H3,(H,26,29)(H,28,32)/b30-19- |
| InChIKey | KIIGJEPIDISDPG-FSGOGVSDSA-N |
| XLogP | 4.74 |
| TPSA | 104.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|