C16H26N2O5 — CID 87757885
ethyl 4-(cyclohexanecarbonyloxycarbamoyl)piperidine-1-carboxylate (PubChem CID 87757885) has the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. Its IUPAC name is ethyl 4-(cyclohexanecarbonyloxycarbamoyl)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(cyclohexanecarbonyloxycarbamoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 87757885 |
| Molecular Formula | C16H26N2O5 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | ethyl 4-(cyclohexanecarbonyloxycarbamoyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C(=O)NOC(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C16H26N2O5/c1-2-22-16(21)18-10-8-12(9-11-18)14(19)17-23-15(20)13-6-4-3-5-7-13/h12-13H,2-11H2,1H3,(H,17,19) |
| InChIKey | CYODRXUWMADYSJ-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|