C18H31N3O4S — CID 87758083
6-[5-[(3aS,4S,6aR)-3-methyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]hexanoic acid (PubChem CID 87758083) has the molecular formula C18H31N3O4S and a molecular weight of 385.53 g/mol. Its IUPAC name is 6-[5-[(3aS,4S,6aR)-3-methyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]hexanoic acid.
| Compound Name | 6-[5-[(3aS,4S,6aR)-3-methyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]hexanoic acid |
|---|---|
| PubChem CID | 87758083 |
| Molecular Formula | C18H31N3O4S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 6-[5-[(3aS,4S,6aR)-3-methyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]hexanoic acid |
| SMILES | CN(CCCCCC(=O)O)C(=O)CCCC[C@@H]1SC[C@@H]2NC(=O)N(C)[C@@H]21 |
| InChI | InChI=1S/C18H31N3O4S/c1-20(11-7-3-4-10-16(23)24)15(22)9-6-5-8-14-17-13(12-26-14)19-18(25)21(17)2/h13-14,17H,3-12H2,1-2H3,(H,19,25)(H,23,24)/t13-,14-,17-/m0/s1 |
| InChIKey | UREVGJDXLXBAIA-ZQIUZPCESA-N |
| XLogP | 2.16 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|