C34H44N4O6S2 — CID 141398828
5-[(3aR,4R,6aS)-3-benzyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid (PubChem CID 141398828) has the molecular formula C34H44N4O6S2 and a molecular weight of 668.88 g/mol. Its IUPAC name is 5-[(3aR,4R,6aS)-3-benzyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid.
| Compound Name | 5-[(3aR,4R,6aS)-3-benzyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid |
|---|---|
| PubChem CID | 141398828 |
| Molecular Formula | C34H44N4O6S2 |
| Molecular Weight | 668.88 g/mol |
| Exact Mass | 668.27 |
| IUPAC Name | 5-[(3aR,4R,6aS)-3-benzyl-2-oxo-3a,4,6,6a-tetrahydro-1H-thieno[3,4-d]imidazol-4-yl]pentanoic acid |
| SMILES | O=C(O)CCCC[C@H]1SC[C@H]2NC(=O)N(Cc3ccccc3)[C@H]21.O=C(O)CCCC[C@H]1SC[C@H]2NC(=O)N(Cc3ccccc3)[C@H]21 |
| InChI | InChI=1S/2C17H22N2O3S/c2*20-15(21)9-5-4-8-14-16-13(11-23-14)18-17(22)19(16)10-12-6-2-1-3-7-12/h2*1-3,6-7,13-14,16H,4-5,8-11H2,(H,18,22)(H,20,21)/t2*13-,14-,16-/m11/s1 |
| InChIKey | ZPDTZRXIDDKSIJ-GUQNQPSVSA-N |
| XLogP | 5.42 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.88 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|