C22H28O7S — CID 87758988
[[2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methoxyphenyl]methoxy-phenylmethyl] methanesulfonate (PubChem CID 87758988) has the molecular formula C22H28O7S and a molecular weight of 436.53 g/mol. Its IUPAC name is [[2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methoxyphenyl]methoxy-phenylmethyl] methanesulfonate.
| Compound Name | [[2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methoxyphenyl]methoxy-phenylmethyl] methanesulfonate |
|---|---|
| PubChem CID | 87758988 |
| Molecular Formula | C22H28O7S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | [[2-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3-methoxyphenyl]methoxy-phenylmethyl] methanesulfonate |
| SMILES | COc1cccc(COC(OS(C)(=O)=O)c2ccccc2)c1CC1COC(C)(C)O1 |
| InChI | InChI=1S/C22H28O7S/c1-22(2)27-15-18(28-22)13-19-17(11-8-12-20(19)25-3)14-26-21(29-30(4,23)24)16-9-6-5-7-10-16/h5-12,18,21H,13-15H2,1-4H3 |
| InChIKey | QLOOSVDHRNIDJC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|